C19H16O3 — CID 53462388
4-(hydroxymethyl)-10,11-dihydrobenzo[a]anthracene-10,11-diol (PubChem CID 53462388) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-(hydroxymethyl)-10,11-dihydrobenzo[a]anthracene-10,11-diol.
| Compound Name | 4-(hydroxymethyl)-10,11-dihydrobenzo[a]anthracene-10,11-diol |
|---|---|
| PubChem CID | 53462388 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-(hydroxymethyl)-10,11-dihydrobenzo[a]anthracene-10,11-diol |
| SMILES | OCc1cccc2c1ccc1cc3c(cc12)C(O)C(O)C=C3 |
| InChI | InChI=1S/C19H16O3/c20-10-13-2-1-3-15-14(13)6-4-11-8-12-5-7-18(21)19(22)17(12)9-16(11)15/h1-9,18-22H,10H2 |
| InChIKey | PJTMSYPBIAPKRA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|