C19H16O2 — CID 25090610
8-methyl-9H-benzo[a]anthracene-8,9-diol (PubChem CID 25090610) has the molecular formula C19H16O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 8-methyl-9H-benzo[a]anthracene-8,9-diol.
| Compound Name | 8-methyl-9H-benzo[a]anthracene-8,9-diol |
|---|---|
| PubChem CID | 25090610 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 8-methyl-9H-benzo[a]anthracene-8,9-diol |
| SMILES | CC1(O)c2cc3ccc4ccccc4c3cc2C=CC1O |
| InChI | InChI=1S/C19H16O2/c1-19(21)17-11-13-7-6-12-4-2-3-5-15(12)16(13)10-14(17)8-9-18(19)20/h2-11,18,20-21H,1H3 |
| InChIKey | UKEYITBZCOYGPX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|