C26H20O4 — CID 10500935
(6S,7S,22R,23R)-hexacyclo[16.8.0.02,11.05,10.012,17.019,24]hexacosa-1(18),2(11),3,5(10),8,12,14,16,19(24),20,25-undecaene-6,7,22,23-tetrol (PubChem CID 10500935) has the molecular formula C26H20O4 and a molecular weight of 396.44 g/mol. Its IUPAC name is (6S,7S,22R,23R)-hexacyclo[16.8.0.02,11.05,10.012,17.019,24]hexacosa-1(18),2(11),3,5(10),8,12,14,16,19(24),20,25-undecaene-6,7,22,23-tetrol.
| Compound Name | (6S,7S,22R,23R)-hexacyclo[16.8.0.02,11.05,10.012,17.019,24]hexacosa-1(18),2(11),3,5(10),8,12,14,16,19(24),20,25-undecaene-6,7,22,23-tetrol |
|---|---|
| PubChem CID | 10500935 |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (6S,7S,22R,23R)-hexacyclo[16.8.0.02,11.05,10.012,17.019,24]hexacosa-1(18),2(11),3,5(10),8,12,14,16,19(24),20,25-undecaene-6,7,22,23-tetrol |
| SMILES | O[C@@H]1C=Cc2c(ccc3c4ccc5c(c4c4ccccc4c23)C=C[C@H](O)[C@H]5O)[C@H]1O |
| InChI | InChI=1S/C26H20O4/c27-21-11-9-17-19(25(21)29)7-5-15-16-6-8-20-18(10-12-22(28)26(20)30)24(16)14-4-2-1-3-13(14)23(15)17/h1-12,21-22,25-30H/t21-,22+,25-,26+ |
| InChIKey | NBVJEMJHDNHSBR-MNHALERFSA-N |
| XLogP | 3.99 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|