C22H19NO3 — CID 10450253
(16S,17R,18S,19R)-16-aminopentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),21-nonaene-17,18,19-triol (PubChem CID 10450253) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (16S,17R,18S,19R)-16-aminopentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),21-nonaene-17,18,19-triol.
| Compound Name | (16S,17R,18S,19R)-16-aminopentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),21-nonaene-17,18,19-triol |
|---|---|
| PubChem CID | 10450253 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (16S,17R,18S,19R)-16-aminopentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),21-nonaene-17,18,19-triol |
| SMILES | N[C@H]1c2c(ccc3c4ccccc4c4ccccc4c23)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H19NO3/c23-19-18-16(20(24)22(26)21(19)25)10-9-15-13-7-2-1-5-11(13)12-6-3-4-8-14(12)17(15)18/h1-10,19-22,24-26H,23H2/t19-,20+,21+,22-/m0/s1 |
| InChIKey | YHZAHNXAJKWXRT-CBPXPLCBSA-N |
| XLogP | 2.91 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|