C26H18O3 — CID 100923592
(20R,22S,23S,24R)-21-oxaheptacyclo[16.9.0.02,11.05,10.012,17.019,25.020,22]heptacosa-1(18),2(11),3,5,7,9,12,14,16,19(25),26-undecaene-23,24-diol (PubChem CID 100923592) has the molecular formula C26H18O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (20R,22S,23S,24R)-21-oxaheptacyclo[16.9.0.02,11.05,10.012,17.019,25.020,22]heptacosa-1(18),2(11),3,5,7,9,12,14,16,19(25),26-undecaene-23,24-diol.
| Compound Name | (20R,22S,23S,24R)-21-oxaheptacyclo[16.9.0.02,11.05,10.012,17.019,25.020,22]heptacosa-1(18),2(11),3,5,7,9,12,14,16,19(25),26-undecaene-23,24-diol |
|---|---|
| PubChem CID | 100923592 |
| Molecular Formula | C26H18O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (20R,22S,23S,24R)-21-oxaheptacyclo[16.9.0.02,11.05,10.012,17.019,25.020,22]heptacosa-1(18),2(11),3,5,7,9,12,14,16,19(25),26-undecaene-23,24-diol |
| SMILES | O[C@@H]1[C@@H]2O[C@@H]2c2c(ccc3c4ccc5ccccc5c4c4ccccc4c23)[C@H]1O |
| InChI | InChI=1S/C26H18O3/c27-23-19-12-11-18-17-10-9-13-5-1-2-6-14(13)20(17)15-7-3-4-8-16(15)21(18)22(19)25-26(29-25)24(23)28/h1-12,23-28H/t23-,24+,25-,26+/m1/s1 |
| InChIKey | NGASRDACJOOJMT-ZJSPYRCASA-N |
| XLogP | 5.15 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|