C18H16O4 — CID 164664851
(2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol (PubChem CID 164664851) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 164664851 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (2S,3R,4S)-1,2,3,4-tetrahydrochrysene-1,2,3,4-tetrol |
| SMILES | OC1c2ccc3c(ccc4ccccc43)c2[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H16O4/c19-15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16(20)18(22)17(15)21/h1-8,15-22H/t15?,16-,17-,18+/m0/s1 |
| InChIKey | ZCFVVVKVNJPHDJ-XFYFCPPXSA-N |
| XLogP | 1.80 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|