C19H17BrO3 — CID 23254026
(1R,2S,3R,4S)-3-bromo-11-methyl-1,2,3,4-tetrahydrochrysene-1,2,4-triol (PubChem CID 23254026) has the molecular formula C19H17BrO3 and a molecular weight of 373.25 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-bromo-11-methyl-1,2,3,4-tetrahydrochrysene-1,2,4-triol.
| Compound Name | (1R,2S,3R,4S)-3-bromo-11-methyl-1,2,3,4-tetrahydrochrysene-1,2,4-triol |
|---|---|
| PubChem CID | 23254026 |
| Molecular Formula | C19H17BrO3 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (1R,2S,3R,4S)-3-bromo-11-methyl-1,2,3,4-tetrahydrochrysene-1,2,4-triol |
| SMILES | Cc1cc2c(c3ccc4ccccc4c13)[C@H](O)[C@@H](Br)[C@@H](O)[C@@H]2O |
| InChI | InChI=1S/C19H17BrO3/c1-9-8-13-15(18(22)16(20)19(23)17(13)21)12-7-6-10-4-2-3-5-11(10)14(9)12/h2-8,16-19,21-23H,1H3/t16-,17-,18+,19-/m1/s1 |
| InChIKey | HSZMTTQZOMKCKM-AKHDSKFASA-N |
| XLogP | 3.51 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|