C18H16O2 — CID 53463158
11-methyl-16,17-dihydro-15H-cyclopenta[a]phenanthrene-16,17-diol (PubChem CID 53463158) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 11-methyl-16,17-dihydro-15H-cyclopenta[a]phenanthrene-16,17-diol.
| Compound Name | 11-methyl-16,17-dihydro-15H-cyclopenta[a]phenanthrene-16,17-diol |
|---|---|
| PubChem CID | 53463158 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 11-methyl-16,17-dihydro-15H-cyclopenta[a]phenanthrene-16,17-diol |
| SMILES | Cc1cc2c(c3ccc4ccccc4c13)CC(O)C2O |
| InChI | InChI=1S/C18H16O2/c1-10-8-15-14(9-16(19)18(15)20)13-7-6-11-4-2-3-5-12(11)17(10)13/h2-8,16,18-20H,9H2,1H3 |
| InChIKey | REZHGDZPAPULAX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|