C20H16O3 — CID 5287739
(7R,8R,9R)-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol (PubChem CID 5287739) has the molecular formula C20H16O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is (7R,8R,9R)-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol.
| Compound Name | (7R,8R,9R)-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol |
|---|---|
| PubChem CID | 5287739 |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (7R,8R,9R)-7,8,9,10-tetrahydrobenzo[a]pyrene-7,8,9-triol |
| SMILES | O[C@@H]1[C@H](O)Cc2c(cc3ccc4cccc5ccc2c3c45)[C@H]1O |
| InChI | InChI=1S/C20H16O3/c21-16-9-14-13-7-6-11-3-1-2-10-4-5-12(18(13)17(10)11)8-15(14)19(22)20(16)23/h1-8,16,19-23H,9H2/t16-,19-,20-/m1/s1 |
| InChIKey | GFANZDFKCCJYRF-NSISKUIASA-N |
| XLogP | 2.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|