C21H16 — CID 58161561
4,5-dimethylpentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1(18),2(6),4,7,9,11(19),12,14,16-nonaene (PubChem CID 58161561) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4,5-dimethylpentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1(18),2(6),4,7,9,11(19),12,14,16-nonaene.
| Compound Name | 4,5-dimethylpentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1(18),2(6),4,7,9,11(19),12,14,16-nonaene |
|---|---|
| PubChem CID | 58161561 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4,5-dimethylpentacyclo[9.6.2.02,6.08,18.015,19]nonadeca-1(18),2(6),4,7,9,11(19),12,14,16-nonaene |
| SMILES | CC1=C(C)c2cc3ccc4cccc5ccc(c2C1)c3c45 |
| InChI | InChI=1S/C21H16/c1-12-10-19-17-9-8-15-5-3-4-14-6-7-16(21(17)20(14)15)11-18(19)13(12)2/h3-9,11H,10H2,1-2H3 |
| InChIKey | IFMGNGLCMAZYHK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|