C21H16 — CID 177091322
13,14-dimethylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),13,15(19)-nonaene (PubChem CID 177091322) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is 13,14-dimethylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),13,15(19)-nonaene.
| Compound Name | 13,14-dimethylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),13,15(19)-nonaene |
|---|---|
| PubChem CID | 177091322 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 13,14-dimethylpentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),13,15(19)-nonaene |
| SMILES | CC1=C(C)c2cc3cccc4ccc5ccc(c2c5c43)C1 |
| InChI | InChI=1S/C21H16/c1-12-10-17-9-8-15-7-6-14-4-3-5-16-11-18(13(12)2)20(17)21(15)19(14)16/h3-9,11H,10H2,1-2H3 |
| InChIKey | IONDLPBEVXILPW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|