C20H16 — CID 168732430
2,4-dimethylpentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene (PubChem CID 168732430) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2,4-dimethylpentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene.
| Compound Name | 2,4-dimethylpentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene |
|---|---|
| PubChem CID | 168732430 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2,4-dimethylpentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16),8,10(15),11,13-octaene |
| SMILES | Cc1cc(C)c2c3c1Cc1ccc4cccc(c4c1-3)C2 |
| InChI | InChI=1S/C20H16/c1-11-8-12(2)17-10-15-7-6-13-4-3-5-14-9-16(11)20(17)19(15)18(13)14/h3-8H,9-10H2,1-2H3 |
| InChIKey | LVHGOZKLFRFAQQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |