C14H15P — CID 177264730
3,6-dimethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (PubChem CID 177264730) has the molecular formula C14H15P and a molecular weight of 214.25 g/mol. Its IUPAC name is 3,6-dimethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene.
| Compound Name | 3,6-dimethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
|---|---|
| PubChem CID | 177264730 |
| Molecular Formula | C14H15P |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3,6-dimethyl-3-phosphatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| SMILES | Cc1ccc2cccc3c2c1CP(C)C3 |
| InChI | InChI=1S/C14H15P/c1-10-6-7-11-4-3-5-12-8-15(2)9-13(10)14(11)12/h3-7H,8-9H2,1-2H3 |
| InChIKey | GVZGVYCCIKKQAX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|