About 9-bromo-1-methylpyrene
9-bromo-1-methylpyrene (PubChem CID 144757480) has the molecular formula C17H11Br
and a molecular weight of 295.18 g/mol. Its IUPAC name is 9-bromo-1-methylpyrene.
Molecular Properties
| Compound Name | 9-bromo-1-methylpyrene |
| PubChem CID | 144757480 |
| Molecular Formula | C17H11Br |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 9-bromo-1-methylpyrene |
| SMILES | Cc1ccc2ccc3cccc4c(Br)cc1c2c34 |
| InChI | InChI=1S/C17H11Br/c1-10-5-6-12-8-7-11-3-2-4-13-15(18)9-14(10)17(12)16(11)13/h2-9H,1H3 |
| InChIKey | LJIXWFYCAUTBRS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-bromo-1-methylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-1-methylpyrene?
The IUPAC name of 9-bromo-1-methylpyrene (CID 144757480) is 9-bromo-1-methylpyrene.
What is the SMILES notation for 9-bromo-1-methylpyrene?
The canonical SMILES for 9-bromo-1-methylpyrene is Cc1ccc2ccc3cccc4c(Br)cc1c2c34.
What is the InChIKey of 9-bromo-1-methylpyrene?
The InChIKey is LJIXWFYCAUTBRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Br/c1-10-5-6-12-8-7-11-3-2-4-13-15(18)9-14(10)17(12)16(11)13/h2-9H,1H3.
What are the key properties of 9-bromo-1-methylpyrene?
9-bromo-1-methylpyrene has a molecular weight of 295.18 g/mol, XLogP of 5.65, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-1-methylpyrene is sourced from PubChem (CID 144757480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).