About 1-bromo-2,8-dimethylpyrene
1-bromo-2,8-dimethylpyrene (PubChem CID 175605672) has the molecular formula C18H13Br
and a molecular weight of 309.21 g/mol. Its IUPAC name is 1-bromo-2,8-dimethylpyrene.
Molecular Properties
| Compound Name | 1-bromo-2,8-dimethylpyrene |
| PubChem CID | 175605672 |
| Molecular Formula | C18H13Br |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1-bromo-2,8-dimethylpyrene |
| SMILES | Cc1cc2ccc3ccc(C)c4ccc(c1Br)c2c34 |
| InChI | InChI=1S/C18H13Br/c1-10-3-4-12-5-6-13-9-11(2)18(19)15-8-7-14(10)16(12)17(13)15/h3-9H,1-2H3 |
| InChIKey | JXAQLUSSMLMTJK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,8-dimethylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,8-dimethylpyrene?
The IUPAC name of 1-bromo-2,8-dimethylpyrene (CID 175605672) is 1-bromo-2,8-dimethylpyrene.
What is the SMILES notation for 1-bromo-2,8-dimethylpyrene?
The canonical SMILES for 1-bromo-2,8-dimethylpyrene is Cc1cc2ccc3ccc(C)c4ccc(c1Br)c2c34.
What is the InChIKey of 1-bromo-2,8-dimethylpyrene?
The InChIKey is JXAQLUSSMLMTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Br/c1-10-3-4-12-5-6-13-9-11(2)18(19)15-8-7-14(10)16(12)17(13)15/h3-9H,1-2H3.
What are the key properties of 1-bromo-2,8-dimethylpyrene?
1-bromo-2,8-dimethylpyrene has a molecular weight of 309.21 g/mol, XLogP of 5.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,8-dimethylpyrene is sourced from PubChem (CID 175605672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).