About pyrene;1,3-xylene
pyrene;1,3-xylene (PubChem CID 174892551) has the molecular formula C24H20
and a molecular weight of 308.42 g/mol. Its IUPAC name is pyrene;1,3-xylene.
Molecular Properties
| Compound Name | pyrene;1,3-xylene |
| PubChem CID | 174892551 |
| Molecular Formula | C24H20 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | pyrene;1,3-xylene |
| SMILES | Cc1cccc(C)c1.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C8H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-7-4-3-5-8(2)6-7/h1-10H;3-6H,1-2H3 |
| InChIKey | LOUZUUHOLAIEGZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene;1,3-xylene?
The IUPAC name of pyrene;1,3-xylene (CID 174892551) is pyrene;1,3-xylene.
What is the SMILES notation for pyrene;1,3-xylene?
The canonical SMILES for pyrene;1,3-xylene is Cc1cccc(C)c1.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of pyrene;1,3-xylene?
The InChIKey is LOUZUUHOLAIEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C8H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-7-4-3-5-8(2)6-7/h1-10H;3-6H,1-2H3.
What are the key properties of pyrene;1,3-xylene?
pyrene;1,3-xylene has a molecular weight of 308.42 g/mol, XLogP of 6.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene;1,3-xylene is sourced from PubChem (CID 174892551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).