About pyrene;zirconium
pyrene;zirconium (PubChem CID 175873743) has the molecular formula C16H10Zr
and a molecular weight of 293.48 g/mol. Its IUPAC name is pyrene;zirconium.
Molecular Properties
| Compound Name | pyrene;zirconium |
| PubChem CID | 175873743 |
| Molecular Formula | C16H10Zr |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | pyrene;zirconium |
| SMILES | [Zr].c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.Zr/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;/h1-10H; |
| InChIKey | ZEAKDZJCZZPOTC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrene;zirconium?
The IUPAC name of pyrene;zirconium (CID 175873743) is pyrene;zirconium.
What is the SMILES notation for pyrene;zirconium?
The canonical SMILES for pyrene;zirconium is [Zr].c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of pyrene;zirconium?
The InChIKey is ZEAKDZJCZZPOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.Zr/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;/h1-10H;.
What are the key properties of pyrene;zirconium?
pyrene;zirconium has a molecular weight of 293.48 g/mol, XLogP of 4.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pyrene;zirconium is sourced from PubChem (CID 175873743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).