About bis(N-phenylaniline);pyrene
bis(N-phenylaniline);pyrene (PubChem CID 174938997) has the molecular formula C40H32N2
and a molecular weight of 540.71 g/mol. Its IUPAC name is bis(N-phenylaniline);pyrene.
Molecular Properties
| Compound Name | bis(N-phenylaniline);pyrene |
| PubChem CID | 174938997 |
| Molecular Formula | C40H32N2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | bis(N-phenylaniline);pyrene |
| SMILES | c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc(Nc2ccccc2)cc1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H10.2C12H11N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H;2*1-10,13H |
| InChIKey | NTSPPLHIBLNPHT-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(N-phenylaniline);pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-phenylaniline);pyrene?
The IUPAC name of bis(N-phenylaniline);pyrene (CID 174938997) is bis(N-phenylaniline);pyrene.
What is the SMILES notation for bis(N-phenylaniline);pyrene?
The canonical SMILES for bis(N-phenylaniline);pyrene is c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc(Nc2ccccc2)cc1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of bis(N-phenylaniline);pyrene?
The InChIKey is NTSPPLHIBLNPHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.2C12H11N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;2*1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H;2*1-10,13H.
What are the key properties of bis(N-phenylaniline);pyrene?
bis(N-phenylaniline);pyrene has a molecular weight of 540.71 g/mol, XLogP of 11.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-phenylaniline);pyrene is sourced from PubChem (CID 174938997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).