About CID 175904297
CID 175904297 (PubChem CID 175904297) has the molecular formula C24H21N3Na2
and a molecular weight of 397.43 g/mol.
Molecular Properties
| Compound Name | CID 175904297 |
| PubChem CID | 175904297 |
| Molecular Formula | C24H21N3Na2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | — |
| SMILES | [Na].[Na].c1ccc(Nc2cc(Nc3ccccc3)cc(Nc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H21N3.2Na/c1-4-10-19(11-5-1)25-22-16-23(26-20-12-6-2-7-13-20)18-24(17-22)27-21-14-8-3-9-15-21;;/h1-18,25-27H;; |
| InChIKey | SGKNHDDJBRLFRV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 175904297 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175904297?
The IUPAC name of CID 175904297 (CID 175904297) is not available.
What is the SMILES notation for CID 175904297?
The canonical SMILES for CID 175904297 is [Na].[Na].c1ccc(Nc2cc(Nc3ccccc3)cc(Nc3ccccc3)c2)cc1.
What is the InChIKey of CID 175904297?
The InChIKey is SGKNHDDJBRLFRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3.2Na/c1-4-10-19(11-5-1)25-22-16-23(26-20-12-6-2-7-13-20)18-24(17-22)27-21-14-8-3-9-15-21;;/h1-18,25-27H;;.
What are the key properties of CID 175904297?
CID 175904297 has a molecular weight of 397.43 g/mol, XLogP of 6.16, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175904297 is sourced from PubChem (CID 175904297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).