About 4-anilino-2,6-dibromophenol
4-anilino-2,6-dibromophenol (PubChem CID 25129835) has the molecular formula C12H9Br2NO
and a molecular weight of 343.02 g/mol. Its IUPAC name is 4-anilino-2,6-dibromophenol.
Molecular Properties
| Compound Name | 4-anilino-2,6-dibromophenol |
| PubChem CID | 25129835 |
| Molecular Formula | C12H9Br2NO |
| Molecular Weight | 343.02 g/mol |
| Exact Mass | 340.91 |
| IUPAC Name | 4-anilino-2,6-dibromophenol |
| SMILES | Oc1c(Br)cc(Nc2ccccc2)cc1Br |
| InChI | InChI=1S/C12H9Br2NO/c13-10-6-9(7-11(14)12(10)16)15-8-4-2-1-3-5-8/h1-7,15-16H |
| InChIKey | UGRUGSDBTFHEOW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.02 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-anilino-2,6-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilino-2,6-dibromophenol?
The IUPAC name of 4-anilino-2,6-dibromophenol (CID 25129835) is 4-anilino-2,6-dibromophenol.
What is the SMILES notation for 4-anilino-2,6-dibromophenol?
The canonical SMILES for 4-anilino-2,6-dibromophenol is Oc1c(Br)cc(Nc2ccccc2)cc1Br.
What is the InChIKey of 4-anilino-2,6-dibromophenol?
The InChIKey is UGRUGSDBTFHEOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br2NO/c13-10-6-9(7-11(14)12(10)16)15-8-4-2-1-3-5-8/h1-7,15-16H.
What are the key properties of 4-anilino-2,6-dibromophenol?
4-anilino-2,6-dibromophenol has a molecular weight of 343.02 g/mol, XLogP of 4.66, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilino-2,6-dibromophenol is sourced from PubChem (CID 25129835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).