C13H9Br2NO2 — CID 17404
3,5-dibromo-2-hydroxy-N-phenylbenzamide (PubChem CID 17404) has the molecular formula C13H9Br2NO2 and a molecular weight of 371.03 g/mol. Its IUPAC name is 3,5-dibromo-2-hydroxy-N-phenylbenzamide.
| Compound Name | 3,5-dibromo-2-hydroxy-N-phenylbenzamide |
|---|---|
| PubChem CID | 17404 |
| Molecular Formula | C13H9Br2NO2 |
| Molecular Weight | 371.03 g/mol |
| Exact Mass | 368.90 |
| IUPAC Name | 3,5-dibromo-2-hydroxy-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C13H9Br2NO2/c14-8-6-10(12(17)11(15)7-8)13(18)16-9-4-2-1-3-5-9/h1-7,17H,(H,16,18) |
| InChIKey | YALKQBRWLMDVSA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.03 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |