C13H11Br3NO6PZn2 — CID 173256364
phosphoric acid;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide;zinc (PubChem CID 173256364) has the molecular formula C13H11Br3NO6PZn2 and a molecular weight of 678.70 g/mol. Its IUPAC name is phosphoric acid;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide;zinc.
| Compound Name | phosphoric acid;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide;zinc |
|---|---|
| PubChem CID | 173256364 |
| Molecular Formula | C13H11Br3NO6PZn2 |
| Molecular Weight | 678.70 g/mol |
| Exact Mass | 672.65 |
| IUPAC Name | phosphoric acid;3,4,5-tribromo-2-hydroxy-N-phenylbenzamide;zinc |
| SMILES | O=C(Nc1ccccc1)c1cc(Br)c(Br)c(Br)c1O.O=P(O)(O)O.[Zn].[Zn] |
| InChI | InChI=1S/C13H8Br3NO2.H3O4P.2Zn/c14-9-6-8(12(18)11(16)10(9)15)13(19)17-7-4-2-1-3-5-7;1-5(2,3)4;;/h1-6,18H,(H,17,19);(H3,1,2,3,4);; |
| InChIKey | KSVIVYLVFMLTIM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.70 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|