C17H13NNaO2+ — CID 21118656
sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 21118656) has the molecular formula C17H13NNaO2+ and a molecular weight of 286.29 g/mol. Its IUPAC name is sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 21118656 |
| Molecular Formula | C17H13NNaO2+ |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2ccccc2cc1O.[Na+] |
| InChI | InChI=1S/C17H13NO2.Na/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;/h1-11,19H,(H,18,20);/q;+1 |
| InChIKey | JKGIEFOEBSORIY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |