sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide

C17H13NNaO2+ — CID 21118656

IUPACsodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide
SMILESO=C(Nc1ccccc1)c1cc2ccccc2cc1O.[Na+]
InChIInChI=1S/C17H13NO2.Na/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;/h1-11,19H,(H,18,20);/q;+1
InChIKeyJKGIEFOEBSORIY-UHFFFAOYSA-N
MW286.29 g/mol
LogP0.80
Rot. Bonds2

About sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide

sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 21118656) has the molecular formula C17H13NNaO2+ and a molecular weight of 286.29 g/mol. Its IUPAC name is sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide.

Molecular Properties

Compound Namesodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide
PubChem CID21118656
Molecular FormulaC17H13NNaO2+
Molecular Weight286.29 g/mol
Exact Mass286.08
IUPAC Namesodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide
SMILESO=C(Nc1ccccc1)c1cc2ccccc2cc1O.[Na+]
InChIInChI=1S/C17H13NO2.Na/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;/h1-11,19H,(H,18,20);/q;+1
InChIKeyJKGIEFOEBSORIY-UHFFFAOYSA-N
XLogP0.80
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.29
LogP ≤ 50.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide?
The IUPAC name of sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide (CID 21118656) is sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide.
What is the SMILES notation for sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide?
The canonical SMILES for sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide is O=C(Nc1ccccc1)c1cc2ccccc2cc1O.[Na+].
What is the InChIKey of sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide?
The InChIKey is JKGIEFOEBSORIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2.Na/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;/h1-11,19H,(H,18,20);/q;+1.
What are the key properties of sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide?
sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide has a molecular weight of 286.29 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-hydroxy-N-phenylnaphthalene-2-carboxamide is sourced from PubChem (CID 21118656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).