C18H15NO4 — CID 20667848
7-(hydroperoxymethyl)-3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 20667848) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 7-(hydroperoxymethyl)-3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 7-(hydroperoxymethyl)-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 20667848 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 7-(hydroperoxymethyl)-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2cc(COO)ccc2cc1O |
| InChI | InChI=1S/C18H15NO4/c20-17-10-13-7-6-12(11-23-22)8-14(13)9-16(17)18(21)19-15-4-2-1-3-5-15/h1-10,20,22H,11H2,(H,19,21) |
| InChIKey | NCGYBGGVFMENKQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|