C29H25N3O4S — CID 70504923
4-(4-aminophenyl)sulfonylaniline;3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 70504923) has the molecular formula C29H25N3O4S and a molecular weight of 511.60 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonylaniline;3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | 4-(4-aminophenyl)sulfonylaniline;3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70504923 |
| Molecular Formula | C29H25N3O4S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylaniline;3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.O=C(Nc1ccccc1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C17H13NO2.C12H12N2O2S/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-11,19H,(H,18,20);1-8H,13-14H2 |
| InChIKey | JDJMKGJREGTTLZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|