C26H27N3O4S — CID 90862263
N-[3-(dimethylamino)phenyl]methanesulfonamide;3-hydroxy-N-phenylnaphthalene-2-carboxamide (PubChem CID 90862263) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[3-(dimethylamino)phenyl]methanesulfonamide;3-hydroxy-N-phenylnaphthalene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)phenyl]methanesulfonamide;3-hydroxy-N-phenylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 90862263 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[3-(dimethylamino)phenyl]methanesulfonamide;3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| SMILES | CN(C)c1cccc(NS(C)(=O)=O)c1.O=C(Nc1ccccc1)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C17H13NO2.C9H14N2O2S/c19-16-11-13-7-5-4-6-12(13)10-15(16)17(20)18-14-8-2-1-3-9-14;1-11(2)9-6-4-5-8(7-9)10-14(3,12)13/h1-11,19H,(H,18,20);4-7,10H,1-3H3 |
| InChIKey | CCABHDRVOYPXSP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |