C12H21AsN2O2S — CID 174776208
N-[3-[2-dimethylarsanylethyl(methyl)amino]phenyl]methanesulfonamide (PubChem CID 174776208) has the molecular formula C12H21AsN2O2S and a molecular weight of 332.30 g/mol. Its IUPAC name is N-[3-[2-dimethylarsanylethyl(methyl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[3-[2-dimethylarsanylethyl(methyl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 174776208 |
| Molecular Formula | C12H21AsN2O2S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-[3-[2-dimethylarsanylethyl(methyl)amino]phenyl]methanesulfonamide |
| SMILES | CN(CC[As](C)C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H21AsN2O2S/c1-13(2)8-9-15(3)12-7-5-6-11(10-12)14-18(4,16)17/h5-7,10,14H,8-9H2,1-4H3 |
| InChIKey | YCSZUOXEOVYYHM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|