C7H8LiNO5S2 — CID 58858821
lithium 3-(methanesulfonamido)benzenesulfonate (PubChem CID 58858821) has the molecular formula C7H8LiNO5S2 and a molecular weight of 257.22 g/mol. Its IUPAC name is lithium 3-(methanesulfonamido)benzenesulfonate.
| Compound Name | lithium 3-(methanesulfonamido)benzenesulfonate |
|---|---|
| PubChem CID | 58858821 |
| Molecular Formula | C7H8LiNO5S2 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | lithium 3-(methanesulfonamido)benzenesulfonate |
| SMILES | CS(=O)(=O)Nc1cccc(S(=O)(=O)[O-])c1.[Li+] |
| InChI | InChI=1S/C7H9NO5S2.Li/c1-14(9,10)8-6-3-2-4-7(5-6)15(11,12)13;/h2-5,8H,1H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | PMIFCOFCUBCTOI-UHFFFAOYSA-M |
| XLogP | -3.03 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|