About sodium 3-methylbenzenesulfonate
sodium 3-methylbenzenesulfonate (PubChem CID 23684709) has the molecular formula C7H7NaO3S
and a molecular weight of 194.19 g/mol. Its IUPAC name is sodium 3-methylbenzenesulfonate.
Molecular Properties
| Compound Name | sodium 3-methylbenzenesulfonate |
| PubChem CID | 23684709 |
| Molecular Formula | C7H7NaO3S |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | sodium 3-methylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C7H8O3S.Na/c1-6-3-2-4-7(5-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | WGGICLLPYNXXCK-UHFFFAOYSA-M |
| XLogP | -2.10 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-methylbenzenesulfonate?
The IUPAC name of sodium 3-methylbenzenesulfonate (CID 23684709) is sodium 3-methylbenzenesulfonate.
What is the SMILES notation for sodium 3-methylbenzenesulfonate?
The canonical SMILES for sodium 3-methylbenzenesulfonate is Cc1cccc(S(=O)(=O)[O-])c1.[Na+].
What is the InChIKey of sodium 3-methylbenzenesulfonate?
The InChIKey is WGGICLLPYNXXCK-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O3S.Na/c1-6-3-2-4-7(5-6)11(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium 3-methylbenzenesulfonate?
sodium 3-methylbenzenesulfonate has a molecular weight of 194.19 g/mol, XLogP of -2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methylbenzenesulfonate is sourced from PubChem (CID 23684709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).