C10H17NO2S — CID 143402177
N,3-dimethylbenzenesulfonamide;ethane (PubChem CID 143402177) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is N,3-dimethylbenzenesulfonamide;ethane.
| Compound Name | N,3-dimethylbenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 143402177 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N,3-dimethylbenzenesulfonamide;ethane |
| SMILES | CC.CNS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C8H11NO2S.C2H6/c1-7-4-3-5-8(6-7)12(10,11)9-2;1-2/h3-6,9H,1-2H3;1-2H3 |
| InChIKey | AZOSAABFISITPG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |