C14H16N2O4S2 — CID 49186392
1-N-methyl-3-N-(4-methylphenyl)benzene-1,3-disulfonamide (PubChem CID 49186392) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-N-methyl-3-N-(4-methylphenyl)benzene-1,3-disulfonamide.
| Compound Name | 1-N-methyl-3-N-(4-methylphenyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 49186392 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-N-methyl-3-N-(4-methylphenyl)benzene-1,3-disulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(S(=O)(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-11-6-8-12(9-7-11)16-22(19,20)14-5-3-4-13(10-14)21(17,18)15-2/h3-10,15-16H,1-2H3 |
| InChIKey | HZZISHDIIABTSR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |