C13H13NO5S2 — CID 21052319
4-[(3-methylphenyl)sulfonylamino]benzenesulfonic acid (PubChem CID 21052319) has the molecular formula C13H13NO5S2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-[(3-methylphenyl)sulfonylamino]benzenesulfonic acid.
| Compound Name | 4-[(3-methylphenyl)sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 21052319 |
| Molecular Formula | C13H13NO5S2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-[(3-methylphenyl)sulfonylamino]benzenesulfonic acid |
| SMILES | Cc1cccc(S(=O)(=O)Nc2ccc(S(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C13H13NO5S2/c1-10-3-2-4-13(9-10)20(15,16)14-11-5-7-12(8-6-11)21(17,18)19/h2-9,14H,1H3,(H,17,18,19) |
| InChIKey | VBRZDHJJEZUDCV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|