About lithium 3-bromobenzenesulfonate
lithium 3-bromobenzenesulfonate (PubChem CID 139842272) has the molecular formula C6H4BrLiO3S
and a molecular weight of 243.01 g/mol. Its IUPAC name is lithium 3-bromobenzenesulfonate.
Molecular Properties
| Compound Name | lithium 3-bromobenzenesulfonate |
| PubChem CID | 139842272 |
| Molecular Formula | C6H4BrLiO3S |
| Molecular Weight | 243.01 g/mol |
| Exact Mass | 241.92 |
| IUPAC Name | lithium 3-bromobenzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(Br)c1.[Li+] |
| InChI | InChI=1S/C6H5BrO3S.Li/c7-5-2-1-3-6(4-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1 |
| InChIKey | UINFYJJFVYUHTI-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.01 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium 3-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 3-bromobenzenesulfonate?
The IUPAC name of lithium 3-bromobenzenesulfonate (CID 139842272) is lithium 3-bromobenzenesulfonate.
What is the SMILES notation for lithium 3-bromobenzenesulfonate?
The canonical SMILES for lithium 3-bromobenzenesulfonate is O=S(=O)([O-])c1cccc(Br)c1.[Li+].
What is the InChIKey of lithium 3-bromobenzenesulfonate?
The InChIKey is UINFYJJFVYUHTI-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5BrO3S.Li/c7-5-2-1-3-6(4-5)11(8,9)10;/h1-4H,(H,8,9,10);/q;+1/p-1.
What are the key properties of lithium 3-bromobenzenesulfonate?
lithium 3-bromobenzenesulfonate has a molecular weight of 243.01 g/mol, XLogP of -1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 3-bromobenzenesulfonate is sourced from PubChem (CID 139842272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).