About bis(3-bromoaniline);sulfate
bis(3-bromoaniline);sulfate (PubChem CID 20836379) has the molecular formula C12H12Br2N2O4S-2
and a molecular weight of 440.11 g/mol. Its IUPAC name is bis(3-bromoaniline);sulfate.
Molecular Properties
| Compound Name | bis(3-bromoaniline);sulfate |
| PubChem CID | 20836379 |
| Molecular Formula | C12H12Br2N2O4S-2 |
| Molecular Weight | 440.11 g/mol |
| Exact Mass | 437.89 |
| IUPAC Name | bis(3-bromoaniline);sulfate |
| SMILES | Nc1cccc(Br)c1.Nc1cccc(Br)c1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C6H6BrN.H2O4S/c2*7-5-2-1-3-6(8)4-5;1-5(2,3)4/h2*1-4H,8H2;(H2,1,2,3,4)/p-2 |
| InChIKey | WYLQFSFOYJALDW-UHFFFAOYSA-L |
| XLogP | 2.72 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.11 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze bis(3-bromoaniline);sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-bromoaniline);sulfate?
The IUPAC name of bis(3-bromoaniline);sulfate (CID 20836379) is bis(3-bromoaniline);sulfate.
What is the SMILES notation for bis(3-bromoaniline);sulfate?
The canonical SMILES for bis(3-bromoaniline);sulfate is Nc1cccc(Br)c1.Nc1cccc(Br)c1.O=S(=O)([O-])[O-].
What is the InChIKey of bis(3-bromoaniline);sulfate?
The InChIKey is WYLQFSFOYJALDW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6BrN.H2O4S/c2*7-5-2-1-3-6(8)4-5;1-5(2,3)4/h2*1-4H,8H2;(H2,1,2,3,4)/p-2.
What are the key properties of bis(3-bromoaniline);sulfate?
bis(3-bromoaniline);sulfate has a molecular weight of 440.11 g/mol, XLogP of 2.72, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-bromoaniline);sulfate is sourced from PubChem (CID 20836379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).