About 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride
3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride (PubChem CID 159407379) has the molecular formula C14H17Br2ClN2O4S2
and a molecular weight of 536.70 g/mol. Its IUPAC name is 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride.
Molecular Properties
| Compound Name | 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride |
| PubChem CID | 159407379 |
| Molecular Formula | C14H17Br2ClN2O4S2 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 533.87 |
| IUPAC Name | 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride |
| SMILES | CS(=O)(=O)Cl.CS(=O)(=O)Nc1cccc(Br)c1.Nc1cccc(Br)c1 |
| InChI | InChI=1S/C7H8BrNO2S.C6H6BrN.CH3ClO2S/c1-12(10,11)9-7-4-2-3-6(8)5-7;7-5-2-1-3-6(8)4-5;1-5(2,3)4/h2-5,9H,1H3;1-4H,8H2;1H3 |
| InChIKey | LODBIYHONSHKOC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride?
The IUPAC name of 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride (CID 159407379) is 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride.
What is the SMILES notation for 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride?
The canonical SMILES for 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride is CS(=O)(=O)Cl.CS(=O)(=O)Nc1cccc(Br)c1.Nc1cccc(Br)c1.
What is the InChIKey of 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride?
The InChIKey is LODBIYHONSHKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO2S.C6H6BrN.CH3ClO2S/c1-12(10,11)9-7-4-2-3-6(8)5-7;7-5-2-1-3-6(8)4-5;1-5(2,3)4/h2-5,9H,1H3;1-4H,8H2;1H3.
What are the key properties of 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride?
3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride has a molecular weight of 536.70 g/mol, XLogP of 4.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoaniline;N-(3-bromophenyl)methanesulfonamide;methanesulfonyl chloride is sourced from PubChem (CID 159407379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).