About aniline;N-phenylmethanesulfonamide
aniline;N-phenylmethanesulfonamide (PubChem CID 157318284) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is aniline;N-phenylmethanesulfonamide.
Molecular Properties
| Compound Name | aniline;N-phenylmethanesulfonamide |
| PubChem CID | 157318284 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | aniline;N-phenylmethanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C7H9NO2S.C6H7N/c1-11(9,10)8-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6/h2-6,8H,1H3;1-5H,7H2 |
| InChIKey | BDWAVHKKMAWPFW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;N-phenylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;N-phenylmethanesulfonamide?
The IUPAC name of aniline;N-phenylmethanesulfonamide (CID 157318284) is aniline;N-phenylmethanesulfonamide.
What is the SMILES notation for aniline;N-phenylmethanesulfonamide?
The canonical SMILES for aniline;N-phenylmethanesulfonamide is CS(=O)(=O)Nc1ccccc1.Nc1ccccc1.
What is the InChIKey of aniline;N-phenylmethanesulfonamide?
The InChIKey is BDWAVHKKMAWPFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.C6H7N/c1-11(9,10)8-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6/h2-6,8H,1H3;1-5H,7H2.
What are the key properties of aniline;N-phenylmethanesulfonamide?
aniline;N-phenylmethanesulfonamide has a molecular weight of 264.35 g/mol, XLogP of 2.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;N-phenylmethanesulfonamide is sourced from PubChem (CID 157318284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).