About benzene;(sulfamoylamino)benzene
benzene;(sulfamoylamino)benzene (PubChem CID 174742453) has the molecular formula C12H14N2O2S
and a molecular weight of 250.32 g/mol. Its IUPAC name is benzene;(sulfamoylamino)benzene.
Molecular Properties
| Compound Name | benzene;(sulfamoylamino)benzene |
| PubChem CID | 174742453 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | benzene;(sulfamoylamino)benzene |
| SMILES | NS(=O)(=O)Nc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C6H8N2O2S.C6H6/c7-11(9,10)8-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,8H,(H2,7,9,10);1-6H |
| InChIKey | BEOSTWCZRDZDIP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;(sulfamoylamino)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;(sulfamoylamino)benzene?
The IUPAC name of benzene;(sulfamoylamino)benzene (CID 174742453) is benzene;(sulfamoylamino)benzene.
What is the SMILES notation for benzene;(sulfamoylamino)benzene?
The canonical SMILES for benzene;(sulfamoylamino)benzene is NS(=O)(=O)Nc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;(sulfamoylamino)benzene?
The InChIKey is BEOSTWCZRDZDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.C6H6/c7-11(9,10)8-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,8H,(H2,7,9,10);1-6H.
What are the key properties of benzene;(sulfamoylamino)benzene?
benzene;(sulfamoylamino)benzene has a molecular weight of 250.32 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;(sulfamoylamino)benzene is sourced from PubChem (CID 174742453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).