N-phenylsulfamoyl chloride

C6H6ClNO2S — CID 11564615

IUPACN-phenylsulfamoyl chloride
SMILESO=S(=O)(Cl)Nc1ccccc1
InChIInChI=1S/C6H6ClNO2S/c7-11(9,10)8-6-4-2-1-3-5-6/h1-5,8H
InChIKeySGSHEKZPIDTZJQ-UHFFFAOYSA-N
MW191.64 g/mol
LogP1.58
Rot. Bonds2

About N-phenylsulfamoyl chloride

N-phenylsulfamoyl chloride (PubChem CID 11564615) has the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. Its IUPAC name is N-phenylsulfamoyl chloride.

Molecular Properties

Compound NameN-phenylsulfamoyl chloride
PubChem CID11564615
Molecular FormulaC6H6ClNO2S
Molecular Weight191.64 g/mol
Exact Mass190.98
IUPAC NameN-phenylsulfamoyl chloride
SMILESO=S(=O)(Cl)Nc1ccccc1
InChIInChI=1S/C6H6ClNO2S/c7-11(9,10)8-6-4-2-1-3-5-6/h1-5,8H
InChIKeySGSHEKZPIDTZJQ-UHFFFAOYSA-N
XLogP1.58
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.64
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-phenylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-phenylsulfamoyl chloride?
The IUPAC name of N-phenylsulfamoyl chloride (CID 11564615) is N-phenylsulfamoyl chloride.
What is the SMILES notation for N-phenylsulfamoyl chloride?
The canonical SMILES for N-phenylsulfamoyl chloride is O=S(=O)(Cl)Nc1ccccc1.
What is the InChIKey of N-phenylsulfamoyl chloride?
The InChIKey is SGSHEKZPIDTZJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO2S/c7-11(9,10)8-6-4-2-1-3-5-6/h1-5,8H.
What are the key properties of N-phenylsulfamoyl chloride?
N-phenylsulfamoyl chloride has a molecular weight of 191.64 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylsulfamoyl chloride is sourced from PubChem (CID 11564615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).