C8H7F4NO5S2 — CID 88855212
1,1,2,2-tetrafluoro-2-(phenylsulfamoyl)ethanesulfonic acid (PubChem CID 88855212) has the molecular formula C8H7F4NO5S2 and a molecular weight of 337.27 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(phenylsulfamoyl)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(phenylsulfamoyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 88855212 |
| Molecular Formula | C8H7F4NO5S2 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(phenylsulfamoyl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H7F4NO5S2/c9-7(10,8(11,12)20(16,17)18)19(14,15)13-6-4-2-1-3-5-6/h1-5,13H,(H,16,17,18) |
| InChIKey | GBPKEYXYIGDCAV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|