C8H9F2NO3S — CID 154485726
1,1-difluoro-2-hydroxy-N-phenylethanesulfonamide (PubChem CID 154485726) has the molecular formula C8H9F2NO3S and a molecular weight of 237.23 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxy-N-phenylethanesulfonamide.
| Compound Name | 1,1-difluoro-2-hydroxy-N-phenylethanesulfonamide |
|---|---|
| PubChem CID | 154485726 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 1,1-difluoro-2-hydroxy-N-phenylethanesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)C(F)(F)CO |
| InChI | InChI=1S/C8H9F2NO3S/c9-8(10,6-12)15(13,14)11-7-4-2-1-3-5-7/h1-5,11-12H,6H2 |
| InChIKey | YVYIXWDUDYRWHF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |