About phenylsulfamoylformic acid
phenylsulfamoylformic acid (PubChem CID 57244146) has the molecular formula C7H7NO4S
and a molecular weight of 201.20 g/mol. Its IUPAC name is phenylsulfamoylformic acid.
Molecular Properties
| Compound Name | phenylsulfamoylformic acid |
| PubChem CID | 57244146 |
| Molecular Formula | C7H7NO4S |
| Molecular Weight | 201.20 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | phenylsulfamoylformic acid |
| SMILES | O=C(O)S(=O)(=O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO4S/c9-7(10)13(11,12)8-6-4-2-1-3-5-6/h1-5,8H,(H,9,10) |
| InChIKey | LYOXZZRSANOKFJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze phenylsulfamoylformic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylsulfamoylformic acid?
The IUPAC name of phenylsulfamoylformic acid (CID 57244146) is phenylsulfamoylformic acid.
What is the SMILES notation for phenylsulfamoylformic acid?
The canonical SMILES for phenylsulfamoylformic acid is O=C(O)S(=O)(=O)Nc1ccccc1.
What is the InChIKey of phenylsulfamoylformic acid?
The InChIKey is LYOXZZRSANOKFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4S/c9-7(10)13(11,12)8-6-4-2-1-3-5-6/h1-5,8H,(H,9,10).
What are the key properties of phenylsulfamoylformic acid?
phenylsulfamoylformic acid has a molecular weight of 201.20 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenylsulfamoylformic acid is sourced from PubChem (CID 57244146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).