C18H18N4O4S2 — CID 139179736
1-N,4-N-bis(phenylsulfamoyl)benzene-1,4-diamine (PubChem CID 139179736) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-N,4-N-bis(phenylsulfamoyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(phenylsulfamoyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 139179736 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-N,4-N-bis(phenylsulfamoyl)benzene-1,4-diamine |
| SMILES | O=S(=O)(Nc1ccccc1)Nc1ccc(NS(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N4O4S2/c23-27(24,19-15-7-3-1-4-8-15)21-17-11-13-18(14-12-17)22-28(25,26)20-16-9-5-2-6-10-16/h1-14,19-22H |
| InChIKey | DKWBKTCUGKOMPX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_E(2)', 'substructure': 'N/A'} |
|---|