C14H14F2O4S2 — CID 171931419
1,1-difluoro-2-hydroxyethanesulfonic acid;phenylsulfanylbenzene (PubChem CID 171931419) has the molecular formula C14H14F2O4S2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1,1-difluoro-2-hydroxyethanesulfonic acid;phenylsulfanylbenzene.
| Compound Name | 1,1-difluoro-2-hydroxyethanesulfonic acid;phenylsulfanylbenzene |
|---|---|
| PubChem CID | 171931419 |
| Molecular Formula | C14H14F2O4S2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1,1-difluoro-2-hydroxyethanesulfonic acid;phenylsulfanylbenzene |
| SMILES | O=S(=O)(O)C(F)(F)CO.c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10S.C2H4F2O4S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;3-2(4,1-5)9(6,7)8/h1-10H;5H,1H2,(H,6,7,8) |
| InChIKey | LHCUWTMAMJBKLJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|