C34H29F3O6S2 — CID 162622919
trifluoromethanesulfonic acid;1,2,3-tris(2-methoxyphenyl)-4-phenylsulfanylbenzene (PubChem CID 162622919) has the molecular formula C34H29F3O6S2 and a molecular weight of 654.73 g/mol. Its IUPAC name is trifluoromethanesulfonic acid;1,2,3-tris(2-methoxyphenyl)-4-phenylsulfanylbenzene.
| Compound Name | trifluoromethanesulfonic acid;1,2,3-tris(2-methoxyphenyl)-4-phenylsulfanylbenzene |
|---|---|
| PubChem CID | 162622919 |
| Molecular Formula | C34H29F3O6S2 |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.14 |
| IUPAC Name | trifluoromethanesulfonic acid;1,2,3-tris(2-methoxyphenyl)-4-phenylsulfanylbenzene |
| SMILES | COc1ccccc1-c1ccc(Sc2ccccc2)c(-c2ccccc2OC)c1-c1ccccc1OC.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C33H28O3S.CHF3O3S/c1-34-28-18-10-7-15-24(28)25-21-22-31(37-23-13-5-4-6-14-23)33(27-17-9-12-20-30(27)36-3)32(25)26-16-8-11-19-29(26)35-2;2-1(3,4)8(5,6)7/h4-22H,1-3H3;(H,5,6,7) |
| InChIKey | TYXZKCUWUGOAMN-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|