About (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate
(4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate (PubChem CID 142712288) has the molecular formula C20H15F3O4S2
and a molecular weight of 440.46 g/mol. Its IUPAC name is (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate |
| PubChem CID | 142712288 |
| Molecular Formula | C20H15F3O4S2 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate |
| SMILES | COc1ccc(SOS(=O)(=O)C(F)(F)F)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H15F3O4S2/c1-26-16-12-13-17(28-27-29(24,25)20(21,22)23)19(15-10-6-3-7-11-15)18(16)14-8-4-2-5-9-14/h2-13H,1H3 |
| InChIKey | BIRUXWCKGDJLKP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate?
The IUPAC name of (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate (CID 142712288) is (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate.
What is the SMILES notation for (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate?
The canonical SMILES for (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate is COc1ccc(SOS(=O)(=O)C(F)(F)F)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate?
The InChIKey is BIRUXWCKGDJLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3O4S2/c1-26-16-12-13-17(28-27-29(24,25)20(21,22)23)19(15-10-6-3-7-11-15)18(16)14-8-4-2-5-9-14/h2-13H,1H3.
What are the key properties of (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate?
(4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate has a molecular weight of 440.46 g/mol, XLogP of 5.90, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2,3-diphenylphenyl)sulfanyl trifluoromethanesulfonate is sourced from PubChem (CID 142712288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).