C14H15ClO2 — CID 175871248
1,3-dimethoxy-2-phenylbenzene;hydrochloride (PubChem CID 175871248) has the molecular formula C14H15ClO2 and a molecular weight of 250.73 g/mol. Its IUPAC name is 1,3-dimethoxy-2-phenylbenzene;hydrochloride.
| Compound Name | 1,3-dimethoxy-2-phenylbenzene;hydrochloride |
|---|---|
| PubChem CID | 175871248 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1,3-dimethoxy-2-phenylbenzene;hydrochloride |
| SMILES | COc1cccc(OC)c1-c1ccccc1.Cl |
| InChI | InChI=1S/C14H14O2.ClH/c1-15-12-9-6-10-13(16-2)14(12)11-7-4-3-5-8-11;/h3-10H,1-2H3;1H |
| InChIKey | ZUIUGDRYTHLOKX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |