C19H14Cl2O — CID 141041687
1,3-dichloro-2-(3-methoxy-2-phenylphenyl)benzene (PubChem CID 141041687) has the molecular formula C19H14Cl2O and a molecular weight of 329.23 g/mol. Its IUPAC name is 1,3-dichloro-2-(3-methoxy-2-phenylphenyl)benzene.
| Compound Name | 1,3-dichloro-2-(3-methoxy-2-phenylphenyl)benzene |
|---|---|
| PubChem CID | 141041687 |
| Molecular Formula | C19H14Cl2O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 1,3-dichloro-2-(3-methoxy-2-phenylphenyl)benzene |
| SMILES | COc1cccc(-c2c(Cl)cccc2Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C19H14Cl2O/c1-22-17-12-5-9-14(18(17)13-7-3-2-4-8-13)19-15(20)10-6-11-16(19)21/h2-12H,1H3 |
| InChIKey | HLKIXDNQYLNCFY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |