C20H20ClO2P — CID 175553236
2-(2-chlorophenyl)-1,3-dimethoxybenzene;phenylphosphane (PubChem CID 175553236) has the molecular formula C20H20ClO2P and a molecular weight of 358.81 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1,3-dimethoxybenzene;phenylphosphane.
| Compound Name | 2-(2-chlorophenyl)-1,3-dimethoxybenzene;phenylphosphane |
|---|---|
| PubChem CID | 175553236 |
| Molecular Formula | C20H20ClO2P |
| Molecular Weight | 358.81 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-(2-chlorophenyl)-1,3-dimethoxybenzene;phenylphosphane |
| SMILES | COc1cccc(OC)c1-c1ccccc1Cl.Pc1ccccc1 |
| InChI | InChI=1S/C14H13ClO2.C6H7P/c1-16-12-8-5-9-13(17-2)14(12)10-6-3-4-7-11(10)15;7-6-4-2-1-3-5-6/h3-9H,1-2H3;1-5H,7H2 |
| InChIKey | MLLPLISWRGIHPZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.81 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|