C21H21O2P — CID 71713664
[2-(2,6-dimethoxyphenyl)phenyl]-methyl-phenylphosphane (PubChem CID 71713664) has the molecular formula C21H21O2P and a molecular weight of 336.37 g/mol. Its IUPAC name is [2-(2,6-dimethoxyphenyl)phenyl]-methyl-phenylphosphane.
| Compound Name | [2-(2,6-dimethoxyphenyl)phenyl]-methyl-phenylphosphane |
|---|---|
| PubChem CID | 71713664 |
| Molecular Formula | C21H21O2P |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | [2-(2,6-dimethoxyphenyl)phenyl]-methyl-phenylphosphane |
| SMILES | COc1cccc(OC)c1-c1ccccc1[P@@](C)c1ccccc1 |
| InChI | InChI=1S/C21H21O2P/c1-22-18-13-9-14-19(23-2)21(18)17-12-7-8-15-20(17)24(3)16-10-5-4-6-11-16/h4-15H,1-3H3/t24-/m0/s1 |
| InChIKey | NGYFQWPXPSGUBI-DEOSSOPVSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|