C45H53O2P — CID 153339770
[2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]-[2-(2,6-dimethoxyphenyl)phenyl]-methylphosphane (PubChem CID 153339770) has the molecular formula C45H53O2P and a molecular weight of 656.89 g/mol. Its IUPAC name is [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]-[2-(2,6-dimethoxyphenyl)phenyl]-methylphosphane.
| Compound Name | [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]-[2-(2,6-dimethoxyphenyl)phenyl]-methylphosphane |
|---|---|
| PubChem CID | 153339770 |
| Molecular Formula | C45H53O2P |
| Molecular Weight | 656.89 g/mol |
| Exact Mass | 656.38 |
| IUPAC Name | [2,6-bis[2,6-di(propan-2-yl)phenyl]phenyl]-[2-(2,6-dimethoxyphenyl)phenyl]-methylphosphane |
| SMILES | COc1cccc(OC)c1-c1ccccc1P(C)c1c(-c2c(C(C)C)cccc2C(C)C)cccc1-c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C45H53O2P/c1-28(2)32-19-14-20-33(29(3)4)42(32)37-23-16-24-38(43-34(30(5)6)21-15-22-35(43)31(7)8)45(37)48(11)41-27-13-12-18-36(41)44-39(46-9)25-17-26-40(44)47-10/h12-31H,1-11H3 |
| InChIKey | LJDSIFQAFVYAQT-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.89 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|